|
| 3-Chloro-10,11-dihydro-5H-dibenzo[b,f]azepine Basic information |
| 3-Chloro-10,11-dihydro-5H-dibenzo[b,f]azepine Chemical Properties |
Melting point | 87 °C | Boiling point | 116-121 °C(Press: 0.09 Torr) | density | 1?+-.0.06 g/cm3(Predicted) | storage temp. | 2-8°C | solubility | DMSO (Slightly), Methanol (Slightly) | form | powder | pka | -0.15±0.20(Predicted) | color | Light Yellow | InChI | InChI=1S/C14H12ClN/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)16-14(11)9-12/h1-4,7-9,16H,5-6H2 | InChIKey | MHUXTOYYIDFXRF-UHFFFAOYSA-N | SMILES | N1C2=CC=CC=C2CCC2=CC=C(Cl)C=C12 | CAS DataBase Reference | 32943-25-2(CAS DataBase Reference) |
| 3-Chloro-10,11-dihydro-5H-dibenzo[b,f]azepine Usage And Synthesis |
Chemical Properties | Pale Yellow Solid | Uses | 3-Chloroiminodibenzyl is a metabolite of Desipramine (D290050) and Clomipramine (C587050). |
| 3-Chloro-10,11-dihydro-5H-dibenzo[b,f]azepine Preparation Products And Raw materials |
|