| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Brassinazole manufacturers
- Brassinazole
-
- $99.00
-
2026-05-11
- CAS:280129-83-1
- Purity: 99.71%
- Supply Ability: 10g
|
| | Brassinazole Basic information |
| Product Name: | Brassinazole | | Synonyms: | 1H-1,2,4-Triazole-1-ethanol, β-[(4-chlorophenyl)methyl]-α-methyl-α-phenyl-, (αR,βS)-rel-;Brassinazole >=98% (HPLC);BRASSINAZOL;ERK2-IN-4 | | CAS: | 280129-83-1 | | MF: | C18H18ClN3O | | MW: | 327.81 | | EINECS: | | | Product Categories: | | | Mol File: | 280129-83-1.mol |  |
| | Brassinazole Chemical Properties |
| Boiling point | 533.1±60.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 5mg/mL, clear (warmed) | | form | powder | | pka | 13.11±0.29(Predicted) | | color | white to beige | | InChI | 1S/C18H18ClN3O/c1-18(23,15-5-3-2-4-6-15)17(22-13-20-12-21-22)11-14-7-9-16(19)10-8-14/h2-10,12-13,17,23H,11H2,1H3/t17-,18+/m1/s1 | | InChIKey | YULDTPKHZNKFEY-MSOLQXFVSA-N | | SMILES | ClC1=CC=C(C[C@@H](N2N=CN=C2)[C@@](C)(O)C3=CC=CC=C3)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Brassinazole Usage And Synthesis |
| Uses | Brassinazole has been used in phenotype analyses to detect morphological changes in G-protein β subunit agb1 mutants. | | Biochem/physiol Actions | Brassinazole induces dwarfism and morphological changes in Arabidopsis, which results in similarity with brassinosteroid deficient mutants. These changes were neutralized by brassinolide treatment, indicating that brassinazole leads to brassinolide deficiency in Arabidopsis. |
| | Brassinazole Preparation Products And Raw materials |
|