|
|
| | 1,1-Diisopropoxycyclohexane Basic information |
| Product Name: | 1,1-Diisopropoxycyclohexane | | Synonyms: | 1,1-Diisopropoxycyclohexane in stock Factory;1,1-DIISOPROPOXYCYCLOHEXANE;CHIPK;CYCLOHEXANONE DIISOPROPYLKETAL;Di-isopropoxycyclohexane;Cyclhexanone diisopropylketal;Cyclohexane, 1,1-bis(1-methylethoxy)-;1,1-DIISOPROPOXY-CYCLOHEXANE(DIPC) | | CAS: | 1132-95-2 | | MF: | C12H24O2 | | MW: | 200.32 | | EINECS: | 413-740-8 | | Product Categories: | | | Mol File: | 1132-95-2.mol |  |
| | 1,1-Diisopropoxycyclohexane Chemical Properties |
| Boiling point | 85°C/8mmHg(lit.) | | density | 0.91 | | refractive index | 1.4410 to 1.4450 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C12H24O2/c1-10(2)13-12(14-11(3)4)8-6-5-7-9-12/h10-11H,5-9H2,1-4H3 | | InChIKey | PLNTYOACSMHWBN-UHFFFAOYSA-N | | SMILES | C1(OC(C)C)(OC(C)C)CCCCC1 | | CAS DataBase Reference | 1132-95-2(CAS DataBase Reference) |
| RIDADR | UN 1760 8/PG II | | HS Code | 2909.20.0000 | | HazardClass | 8 | | PackingGroup | II |
| | 1,1-Diisopropoxycyclohexane Usage And Synthesis |
| Chemical Properties | Clear colourless liquid |
| | 1,1-Diisopropoxycyclohexane Preparation Products And Raw materials |
|