|
|
| | 1-PYRIDIN-2-YLMETHYL-PIPERAZINE Basic information |
| | 1-PYRIDIN-2-YLMETHYL-PIPERAZINE Chemical Properties |
| Boiling point | 91-93°C 0,4mm | | density | 1.073±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | liquid | | pka | 9.00±0.10(Predicted) | | color | Colourless to pale yellow | | InChI | InChI=1S/C10H15N3/c1-2-4-12-10(3-1)9-13-7-5-11-6-8-13/h1-4,11H,5-9H2 | | InChIKey | NATRYEXANYVWAW-UHFFFAOYSA-N | | SMILES | N1(CC2=NC=CC=C2)CCNCC1 | | CAS DataBase Reference | 55579-01-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-PYRIDIN-2-YLMETHYL-PIPERAZINE Usage And Synthesis |
| Uses | 1-(Pyridin-2-ylmethyl)piperazine is a useful intermediate for the preparation of benzylpiperazine and other piperidine derivatives used as antipsychotic agents and in the treatment of skin related diseases. |
| | 1-PYRIDIN-2-YLMETHYL-PIPERAZINE Preparation Products And Raw materials |
|