|
|
| | Linezolid Impurity 48 Basic information |
| Product Name: | Linezolid Impurity 48 | | Synonyms: | (2S)-1-(Acetyloxy)-3-chloropropan-2-yl acetate;1,2-Propanediol, 3-chloro-, diacetate, (2S)- (9CI);Linezolid Impurity 115 | | CAS: | 78692-88-3 | | MF: | C7H11ClO4 | | MW: | 194.61 | | EINECS: | | | Product Categories: | | | Mol File: | 78692-88-3.mol |  |
| | Linezolid Impurity 48 Chemical Properties |
| Boiling point | 245.0±20.0 °C(Predicted) | | density | 1.195±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C7H11ClO4/c1-5(9)11-4-7(3-8)12-6(2)10/h7H,3-4H2,1-2H3/t7-/m1/s1 | | InChIKey | GTFUGSXMTMYKRG-SSDOTTSWSA-N | | SMILES | C(OC(=O)C)[C@H](OC(=O)C)CCl |
| | Linezolid Impurity 48 Usage And Synthesis |
| | Linezolid Impurity 48 Preparation Products And Raw materials |
|