| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:PC biotin-PEG3-NHS ester
CAS:2353409-93-3
Purity:PC biotin-PEG3-NHS ester Package:25MG Remarks:901767-25MG
|
PC biotin-PEG3-NHS ester manufacturers
|
| | PC biotin-PEG3-NHS ester Basic information |
| Product Name: | PC biotin-PEG3-NHS ester | | Synonyms: | PC biotin-PEG3-NHS ester;Carbonic acid, 2,5-dioxo-1-pyrrolidinyl 1-[4-[[22-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-4,18-dioxo-8,11,14-trioxa-5,17-diazadocos-1-yl]oxy]-5-methoxy-2-nitrophenyl]ethyl ester;1-(4-((4,18-Dioxo-22-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)-8,11,14-trioxa-5,17-diazadocosyl)oxy)-5-methoxy-2-nitrophenyl)ethyl (2,5-dioxopyrrolidin-1-yl) carbonate | | CAS: | 2353409-93-3 | | MF: | C36H52N6O15S | | MW: | 840.89 | | EINECS: | | | Product Categories: | ADC LINKER | | Mol File: | 2353409-93-3.mol |  |
| | PC biotin-PEG3-NHS ester Chemical Properties |
| Melting point | 170 °C | | density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 13.90±0.40(Predicted) | | form | solid | | color | Off-white to light yellow | | InChIKey | WXAMRLAFOFNACR-VTJXTUSFSA-N | | SMILES | S1[C@H]([C@H]4NC(=O)N[C@H]4C1)CCCCC(=O)NCCOCCOCCOCCNC(=O)CCCOc2c(cc(c(c2)[N+](=O)[O-])C(OC(=O)ON3C(=O)CCC3=O)C)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | PC biotin-PEG3-NHS ester Usage And Synthesis |
| Description | PC Biotin-PEG3-NHS carbonate ester is a unique amine reactive, photocleavable biotin reagent that allows for reagent-free release of the captured biomolecules from streptavidin beads. This reagent contains a biotin moiety linked to the amine reactive N-hydroxysuccinimidyl (NHS) mixed carbonate through a spacer arm containing a photocleavable moiety. The NHS portion of this compound reacts specifically with primary amine groups on the target molecule(s) to form a carbamate linkage. Captured biomolecules can be efficiently photoreleased, typically >90% in 5-25 minutes using an inexpensive, near-UV, low intensity lamp (e.g. 365 nm lamp at 1-5 mW/cm2). | | Uses | PC biotin-NHS ester is a unique amine-reactive, photocleavable biotin reagent that allows for reagent-free release of the captured biomolecules from streptavidin. This reagent contains a biotin moiety linked to the amine reactive N-hydroxysuccinimidyl (NHS) mixed carbonate through a spacer arm containing a photocleavable moiety. The NHS portion of this compound reacts specifically with primary amine groups on the target molecule(s) to form a carbamate linkage. Captured biomolecules can be efficiently photoreleased, typically >90% in 5-25 minutes using an inexpensive, near-UV, low intensity lamp (e.g. 365 nm lamp at 1-5 mW/cm2). | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent | | IC 50 | Cleavable Linker |
| | PC biotin-PEG3-NHS ester Preparation Products And Raw materials |
|