|
|
| | 6-FLUOROINDOLE-3-ACETIC ACID Basic information |
| | 6-FLUOROINDOLE-3-ACETIC ACID Chemical Properties |
| Melting point | 159-163°C | | Boiling point | 417.9±30.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 4.38±0.30(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | 1S/C10H8FNO2/c11-7-1-2-8-6(3-10(13)14)5-12-9(8)4-7/h1-2,4-5,12H,3H2,(H,13,14) | | InChIKey | OOEZASHYQRURRT-UHFFFAOYSA-N | | SMILES | OC(=O)Cc1c[nH]c2cc(F)ccc12 | | CAS DataBase Reference | 443-75-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 6-FLUOROINDOLE-3-ACETIC ACID Usage And Synthesis |
| Uses | 6-Fluoroindole-3-acetic Acid is a halogenated indole 3-acetic acid derivative that contains a bulky electron withdrawing fluorine making it more favorable for inhibitory activity related to cancer therapy. |
| | 6-FLUOROINDOLE-3-ACETIC ACID Preparation Products And Raw materials |
|