| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
4,4'-Oxybis[benzamide] manufacturers
- OUL35
-
- $31.00
-
2026-07-27
- CAS:6336-34-1
- Purity: 99.30%
- Supply Ability: 10g
|
| | 4,4'-Oxybis[benzamide] Basic information |
| Product Name: | 4,4'-Oxybis[benzamide] | | Synonyms: | 4,4'-Oxybis[benzamide];NSC39047;Benzamide, 4,4'-oxybis-;OUL35 >=98% (HPLC);ARTD10,PARP,inhibit,DNA,OUL 35,NSC 39047,apoptosis,NSC-39047,PARP10,poly ADP ribose polymerase,damage,HeLa,OUL35,Inhibitor,OUL-35;4,4'-Oxydibenzamide , OUL35;4-(4-carbamoylphenoxy)benzamide;OUL35, 10 mM in DMSO | | CAS: | 6336-34-1 | | MF: | C14H12N2O3 | | MW: | 256.26 | | EINECS: | | | Product Categories: | | | Mol File: | 6336-34-1.mol | ![4,4'-Oxybis[benzamide] Structure](CAS/20200119/GIF/6336-34-1.gif) |
| | 4,4'-Oxybis[benzamide] Chemical Properties |
| Boiling point | 488.8±30.0 °C(Predicted) | | density | 1.298±0.06 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | DMF: 5 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:4): 0.20 mg/ml | | form | A crystalline solid | | pka | 15.76±0.50(Predicted) | | color | White to off-white | | InChI | 1S/C14H12N2O3/c15-13(17)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(16)18/h1-8H,(H2,15,17)(H2,16,18) | | InChIKey | XZRCQWLPMXFGHE-UHFFFAOYSA-N | | SMILES | O=C(N)C1=CC=C(OC2=CC=C(C(N)=O)C=C2)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4,4'-Oxybis[benzamide] Usage And Synthesis |
| Uses | OUL35 (NSC39047) is a potent and selective inhibitor of ARTD10 (PARP-10), with an IC50 of 329 nM[1]. | | Biological Activity | OUL35 is a cell penetrant, potent and selective ARTD10/PARP10 inhibitor. OUL35 rescues HeLa cells from ARTD10 induced apoptotic cell death. | | IC 50 | ARTD10/PARP10: 329 nM (IC50) | | storage | Store at +4°C | | References | [1] Harikanth Venkannagari, et al. Small-Molecule Chemical Probe Rescues Cells from Mono-ADP-Ribosyltransferase ARTD10/PARP10-Induced Apoptosis and Sensitizes Cancer Cells to DNA Damage. Cell Chem Biol. 2016 Oct 20;23(10):1251-1260. DOI:10.1016/j.chembiol.2016.08.012 |
| | 4,4'-Oxybis[benzamide] Preparation Products And Raw materials |
|