|
|
| | Tris(3-methoxyphenyl)phosphine Basic information |
| | Tris(3-methoxyphenyl)phosphine Chemical Properties |
| Melting point | 113-115 °C(lit.) | | Boiling point | 476.3±40.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | White to almost white | | InChI | InChI=1S/C21H21O3P/c1-22-16-7-4-10-19(13-16)25(20-11-5-8-17(14-20)23-2)21-12-6-9-18(15-21)24-3/h4-15H,1-3H3 | | InChIKey | CCXTYQMZVYIQRP-UHFFFAOYSA-N | | SMILES | P(C1=CC=CC(OC)=C1)(C1=CC=CC(OC)=C1)C1=CC=CC(OC)=C1 | | CAS DataBase Reference | 29949-84-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29310099 |
| | Tris(3-methoxyphenyl)phosphine Usage And Synthesis |
| Chemical Properties | White to almost white crystalline powder | | Uses | suzuki reaction | | Synthesis | 1-iodo-3-methoxybenzene could be used to synthesize Tri(o-anisole)phosphine (Tris(3-methoxyphenyl)phosphine). Reactions performed using 0.1?mmol NaPH2, 2?mol?% PF6, 11?equiv 1-iodo-3-methoxybenzene, 15?equiv Et3N in 2.0?mL MeCN under blue LED irradiation and N2 atmosphere for 24?h[1].
 | | References | [1]"Photocatalytic Arylation of P4 and PH3: Reaction Development Through Mechanistic Insight." Angewandte Chemie (2021). |
| | Tris(3-methoxyphenyl)phosphine Preparation Products And Raw materials |
|