CORTISOL 17-VALERATE manufacturers
|
| | CORTISOL 17-VALERATE Basic information |
| Product Name: | CORTISOL 17-VALERATE | | Synonyms: | 4-PREGNEN-11-BETA, 17,21-TRIOL-3,20-DIONE 17-VALERATE;11BETA,17,21-TRIHYDROXYPREGN-4-ENE-3,20-DIONE 17-VALERATE;HYDROCORTISONE 17-VALERATE;HYDROCORTISONE VALERATE;CORTISOL 17-VALERATE;11β,17,21-trihydroxypregn-4-ene-3,20-dione 17-valerate;HYDROCORTISONEVALERATE,USP;[(17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] pentanoate | | CAS: | 57524-89-7 | | MF: | C26H38O6 | | MW: | 446.58 | | EINECS: | 260-786-8 | | Product Categories: | WESTCORT;Steroids | | Mol File: | 57524-89-7.mol |  |
| | CORTISOL 17-VALERATE Chemical Properties |
| Melting point | 217-220 °C | | Boiling point | 595.1±50.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly, Heated) | | pka | 12.98±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical | | InChIKey | FZCHYNWYXKICIO-FZNHGJLXSA-N | | SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]4(C)[C@@]2([H])CC[C@]4(OC(=O)CCCC)C(=O)CO |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | HS Code | 2937290000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | CORTISOL 17-VALERATE Usage And Synthesis |
| Uses | antiinflammatory, glucocorticoid | | Uses | Hydrocortisone 17-Valerate is a derivative of Hydrocortisone (H714615) which is a glucocorticoid that is produced by the zona fasciculata of the adrenal gland. | | Definition | ChEBI: Cortisol 17-valerate is a glucocorticoid, a cortisol ester, a valerate ester and a primary alpha-hydroxy ketone. | | Brand name | Westcort (Westwood-Squibb). |
| | CORTISOL 17-VALERATE Preparation Products And Raw materials |
|