|
|
| | 2-METHYL-5-PHENYLFURAN-3-CARBOXYLIC ACID Basic information |
| Product Name: | 2-METHYL-5-PHENYLFURAN-3-CARBOXYLIC ACID | | Synonyms: | BUTTPARK 33\08-19;TIMTEC-BB SBB005426;RARECHEM AL BE 0515;2-methyl-5-phenyl-3-furoic acide;2-METHYL-5-PHENYL-3-FUROIC ACID;2-METHYL-5-PHENYLFURAN-3-CARBOXYLIC ACID;3-Furancarboxylic acid, 2-Methyl-5-phenyl-;2-methyl-5-phenyl-3-furancarboxylate | | CAS: | 108124-17-0 | | MF: | C12H10O3 | | MW: | 202.21 | | EINECS: | | | Product Categories: | | | Mol File: | 108124-17-0.mol |  |
| | 2-METHYL-5-PHENYLFURAN-3-CARBOXYLIC ACID Chemical Properties |
| Melting point | 176 °C | | Boiling point | 357.1±30.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | form | solid | | pka | 4.34±0.26(Predicted) | | color | white to beige | | InChI | 1S/C12H10O3/c1-8-10(12(13)14)7-11(15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14)/p-1 | | InChIKey | VLMNACSEESRUAK-UHFFFAOYSA-M | | SMILES | [O-]C(=O)c1c([o]c(c1)c2ccccc2)C | | CAS DataBase Reference | 108124-17-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2932190090 | | Storage Class | 13 - Non Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 2-METHYL-5-PHENYLFURAN-3-CARBOXYLIC ACID Usage And Synthesis |
| Definition | ChEBI: 2-Methyl-5-phenyl-3-furoic acid is a furoic acid. | | Biological Activity | Jedi1 is an activator of the mechanosensitive Piezo1 channel th at binds at a different place from Yoda1. It exhibits long-range allosteric gating, activating Piezo1 through the extracellular side of its peripheral blade-like structure rather than the C-terminal extracellular domain of the pore. |
| | 2-METHYL-5-PHENYLFURAN-3-CARBOXYLIC ACID Preparation Products And Raw materials |
|