|
|
| | 4-Acetamido-3-bromoacetophenone Basic information |
| | 4-Acetamido-3-bromoacetophenone Chemical Properties |
| Melting point | 139-141°C | | Boiling point | 436.1±40.0 °C(Predicted) | | density | 1.504±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 13.66±0.70(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 3272108 | | InChI | 1S/C10H10BrNO2/c1-6(13)8-3-4-10(9(11)5-8)12-7(2)14/h3-5H,1-2H3,(H,12,14) | | InChIKey | PMYJAVHDFDKJBS-UHFFFAOYSA-N | | SMILES | CC(=O)Nc1ccc(cc1Br)C(C)=O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 22-24/25-45 | | RIDADR | UN 2811 | | WGK Germany | 3 | | HS Code | 2924.29.7790 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| Provider | Language |
|
ALFA
| English |
| | 4-Acetamido-3-bromoacetophenone Usage And Synthesis |
| | 4-Acetamido-3-bromoacetophenone Preparation Products And Raw materials |
|