|
|
| | N-(2-Oxoethyl)phthalimide Basic information |
| | N-(2-Oxoethyl)phthalimide Chemical Properties |
| Melting point | 116-118°C | | Boiling point | 324.3±25.0 °C(Predicted) | | density | 1.376±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly, Heated, Sonicated), Ethyl Acetate (Slightly) | | form | Solid | | pka | -2.45±0.20(Predicted) | | color | White to Pale Yellow | | InChI | InChI=1S/C10H7NO3/c12-6-5-11-9(13)7-3-1-2-4-8(7)10(11)14/h1-4,6H,5H2 | | InChIKey | LMRDBJZQDUVCQH-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CC=O |
| RTECS | TI5125000 | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | N-(2-Oxoethyl)phthalimide Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Phthalimidoacetaldehyde (cas# 2913-97-5) is a compound useful in organic synthesis. | | Synthesis | Example 5: Preparation of N-2-[4-(4-bromo-2-fluorophenylamino)-7-(1-methylpiperidin-4-ylmethoxy)-quinazolin-6-ylamino]-ethyl-propenamide
Step 5-1: Synthesis of 1,3-dioxo-1,3-dihydroisoindol-2-yl acetaldehyde
Phthalimidoacetaldehyde diethyl acetal (10 g, 0.0379 mol) was dissolved in 100 mL of aqueous 1N HCl, refluxed and stirred for 1 hour. Upon completion of the reaction, the reaction solution was extracted with 200 mL of dichloromethane, followed by washing the organic layer with 100 mL of saturated saline. The solvent was removed by distillation under reduced pressure to give N-(2-acetaldehyde-based) phthalimide 7.16 g (yield: 99%).
1H NMR (CDCl3) δ: 9.66 (s, 1H), 7.90-7.84 (m, 2H), 7.78-7.73 (m, 2H), 4.56 (s, 2H). | | References | [1] Tetrahedron, 2002, vol. 58, # 9, p. 1719 - 1737
[2] Tetrahedron, 2008, vol. 64, # 28, p. 6794 - 6800
[3] Patent: WO2007/55513, 2007, A1. Location in patent: Page/Page column 29
[4] Angewandte Chemie - International Edition, 2015, vol. 54, # 33, p. 9668 - 9672
[5] Angew. Chem., 2015, vol. 127, # 33, p. 9804 - 9808,5 |
| | N-(2-Oxoethyl)phthalimide Preparation Products And Raw materials |
|