ETHYL 2-ETHYLACRYLATE 96 manufacturers
|
| | ETHYL 2-ETHYLACRYLATE 96 Basic information |
| | ETHYL 2-ETHYLACRYLATE 96 Chemical Properties |
| Boiling point | 139-145 °C (lit.) | | density | 0.902 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.421(lit.) | | Fp | 89 °F | | storage temp. | 2-8°C | | InChI | InChI=1S/C7H12O2/c1-4-6(3)7(8)9-5-2/h3-5H2,1-2H3 | | InChIKey | OUGJKAQEYOUGKG-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(=C)CC |
| Hazard Codes | Xi,N,F | | Risk Statements | 36/37/38-51/53-11 | | Safety Statements | 26-28-61 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | ETHYL 2-ETHYLACRYLATE 96 Usage And Synthesis |
| | ETHYL 2-ETHYLACRYLATE 96 Preparation Products And Raw materials |
|