|
|
| | 2-(CHLOROMETHYL)-4(3H)-QUINAZOLINONE Basic information |
| | 2-(CHLOROMETHYL)-4(3H)-QUINAZOLINONE Chemical Properties |
| Melting point | 249-253 °C(lit.) | | Boiling point | 340.7±44.0 °C(Predicted) | | density | 1.42 | | storage temp. | -20°C, sealed storage, away from moisture | | form | crystalline powder | | pka | 1.26±0.20(Predicted) | | color | White | | InChI | InChI=1S/C9H7ClN2O/c10-5-8-11-7-4-2-1-3-6(7)9(13)12-8/h1-4H,5H2,(H,11,12,13) | | InChIKey | KSLWZHWJFFDMMK-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(=O)NC=1CCl |
| Hazard Codes | Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 2-(CHLOROMETHYL)-4(3H)-QUINAZOLINONE Usage And Synthesis |
| | 2-(CHLOROMETHYL)-4(3H)-QUINAZOLINONE Preparation Products And Raw materials |
|