| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | endo-3 7 14-Trifluoro-1 3 5 7 9 11 14-& Basic information |
| Product Name: | endo-3 7 14-Trifluoro-1 3 5 7 9 11 14-& | | Synonyms: | ENDO-3,7,14-TRIFLUORO-1,3,7,14-HEPTACYCLO PENTYLTRICYCLO(7.3.3.1)-HEPTASILOXANE;Trifluoro-POSS(R);Tricyclo[7.3.3.15,11]heptasiloxane, 1,3,5,7,9,11,14-heptacyclopentyl-3,7,14-trifluoro-;endo-3,7,14-Trifluoro-1,3,5,7,9,11,14-heptacyclopentyltricyclo[7.3.3.15,11]heptasiloxane;endo-3 7 14-Trifluoro-1 3 5 7 9 11 14-& | | CAS: | 307531-89-1 | | MF: | C35H63F3O9Si7 | | MW: | 881.46 | | EINECS: | | | Product Categories: | | | Mol File: | 307531-89-1.mol |  |
| | endo-3 7 14-Trifluoro-1 3 5 7 9 11 14-& Chemical Properties |
| Melting point | 98-106 °C(lit.) | | density | 1.20±0.1 g/cm3(Predicted) | | InChIKey | MHANYKIZQPHDKI-UHFFFAOYSA-N | | SMILES | F[Si]1(O[Si]2(O[Si](F)(O[Si]3(O[Si](F)(O[Si](O1)(O[Si](O2)(O3)C4CCCC4)C5CCCC5)C6CCCC6)C7CCCC7)C8CCCC8)C9CCCC9)C%10CCCC%10 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | endo-3 7 14-Trifluoro-1 3 5 7 9 11 14-& Usage And Synthesis |
| | endo-3 7 14-Trifluoro-1 3 5 7 9 11 14-& Preparation Products And Raw materials |
|