|
|
| Product Name: | Poly[2-methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene] | | Synonyms: | {1-[(2-ethylhexyl)oxy]-2-Methoxyethenyl}benzene;Poly(2-Methoxy-5-(2'-ethylhexoxy)-1,4-phenylenevinylene);Regular-MEH-PPV;Poly[2-Methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene]
Poly(2-Methoxy-5-(2-ethylhexoxy)-1,4-phenylene vinylene;Poly[2-Methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene];Poly[2-Methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene] average Mn 150,000-250,000;Poly[2-Methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene] average Mn 40,000-70,000;Poly[2-Methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene] average Mn 70,000-100,000 | | CAS: | 138184-36-8 | | MF: | C51H72O6X2 | | MW: | 781.124 | | EINECS: | | | Product Categories: | OTFT/OFET/OPV Materials | | Mol File: | 138184-36-8.mol | ![Poly[2-methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene] Structure](CAS/GIF/138184-36-8.gif) |
| | Poly[2-methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene] Chemical Properties |
| density | 0.99 g/cm3 | | storage temp. | 2-8°C | | form | fibers/powder | | color | Red | | InChI | 1S/C17H26O2/c1-5-8-9-14(6-2)13-19-16-10-11-17(18-4)15(7-3)12-16/h7,10-12,14H,3,5-6,8-9,13H2,1-2,4H3 | | InChIKey | CTUSWJPWMNVXEE-UHFFFAOYSA-N | | SMILES | O(CC(CCCC)CC)c1cc(c(cc1)OC)C=C | | solubility | Toluene or chlorobenzene | | Absorption | λmax 493 nm (toluene) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Poly[2-methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene] Usage And Synthesis |
| Classification | PPV derivatives, Hole-injection layer materials, Hole transport layer materials; Polymer light-emitting diodes (OLEDs), Organic photovoltaics (OPVs), Organic electronics。
| | Applications | Poly[2-methoxy-5-(2’-ethylhexyloxy)-1,4- phenylene vinylene] (MEH-PPV) is a PPV derivative that is particularly favourable for device fabrication due to its great solubility in most of the common organic solvents owing to its asymmetric side chains. To date, MEH-PPV is possibly one of the most celebrated and studied polymer semiconductors, recognising its applications in OPV, OFETs, polymer light-emitting diodes (PLED) and perovskite solar cells.
The first example of a polymer solar cell with a convincing understanding of the physics and chemistry involved was the bilayer heterojunction cell utilising the soluble polymer MEH-PPV and the Buckminsterfullerene C60 where a power conversion efficiency of 0.04% was obtained using monochromatic light.
| | Description | Poly[2-methoxy-5-(2’-ethylhexyloxy)-1,4-phenylene vinylene] (MEH-PPV) is a PPV derivative that is particularly favourable for device fabrication due to its great solubility in most of the common organic solvents owing to its asymmetric side chains. To date, MEH-PPV is possibly one of the most celebrated and studied polymer semiconductors, recognising its applications in OPV, OFETs, polymer light-emitting diodes (PLED) and perovskite solar cells. | | Uses | MEH-PPV can be used as a conducting polymer in the fabrication of the electronic devices such as:
- field effect transistors(FET)
- photovoltaic cells
- light emitting diodes(LED)
- sensors for biomedical applications
- photodiodes
| | Uses | Conducting polymer in solar cells and carbon nanotube OLEDs. Useful in producing bright and efficient white polymeric light emitting diodes. Filter before application. | | General Description | MEH-PPV is a conducting organic semiconductor which has low molecular weight and hydrophobic characteristics. It is a poly(phenylenevinylene) (PPV) derivative and a conjugating polymer with highest occupied molecular orbital (HOMO) below the fermi level of gold. |
| | Poly[2-methoxy-5-(2-ethylhexyloxy)-1,4-phenylenevinylene] Preparation Products And Raw materials |
|