|
|
| | 3-[(2-Aminoethyl)dithio]propionic acid Basic information |
| | 3-[(2-Aminoethyl)dithio]propionic acid Chemical Properties |
| Melting point | 138-141oC | | Boiling point | 339.5±27.0 °C(Predicted) | | density | 1.320±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Soluble in Water, DMSO | | form | A solid | | pka | 4.20±0.10(Predicted) | | color | White to off-white | | Stability: | Hygroscopic | | InChI | InChI=1S/C5H11NO2S2/c6-2-4-10-9-3-1-5(7)8/h1-4,6H2,(H,7,8) | | InChIKey | HMMFDEBVQNRZLJ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCSSCCN |
| | 3-[(2-Aminoethyl)dithio]propionic acid Usage And Synthesis |
| Description | Aminoethyl-SS-propionic acid is a cleavable compound containing a terminal amine and carboxylic acid group. The disulfide bonds can be cleaved using Dithiothreitol (DTT) reagent. The terminal amine can be reacted with carboxylic acid, activated NHS esters and other carbonyl compounds. The terminal carboxylic acid can be reacted with primary amines in the presence of activators such as EDC and HATU to form a stable amide bond. | | Chemical Properties | 3-[(2-AMINOETHYL)DITHIO]PROPIONIC ACID is White Solid | | Uses | 3-[(2-AMINOETHYL)DITHIO]PROPIONIC ACID is a useful reversible immobilization or crossliking reagent | | IC 50 | Disulfide Cleavable Linker; Cleavable Linker |
| | 3-[(2-Aminoethyl)dithio]propionic acid Preparation Products And Raw materials |
|