|
|
| | 4-CHLOROMETHYLBENZALDEHYDE; >95%DISCONTINUED 10/25/01 Basic information | | Application |
| Product Name: | 4-CHLOROMETHYLBENZALDEHYDE; >95%DISCONTINUED 10/25/01 | | Synonyms: | >95%DISCONTINUED;4-CHLOROMETHYLBENZALDEHYDE; >95%DISCONTINUED 10/25/01;α-Chloro-p-tolualdehyde;>95%DISCONTINUED 10/25/01;Benzaldehyde, 4-(chloromethyl)-;Plerixafor Impurity 52;Parachloromethyl benzaldehyde;4-(Chloromethyl)benzaldehyde (Plerixafor Impurity) | | CAS: | 73291-09-5 | | MF: | C8H7ClO | | MW: | 154.59 | | EINECS: | | | Product Categories: | | | Mol File: | 73291-09-5.mol |  |
| | 4-CHLOROMETHYLBENZALDEHYDE; >95%DISCONTINUED 10/25/01 Chemical Properties |
| Melting point | 73 °C | | Boiling point | 265.6±15.0 °C(Predicted) | | density | 1.200±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystalline solid | | color | White | | InChI | InChI=1S/C8H7ClO/c9-5-7-1-3-8(6-10)4-2-7/h1-4,6H,5H2 | | InChIKey | FNIFQOISPAAFQF-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(CCl)C=C1 |
| RIDADR | 3261 | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 2913000090 |
| | 4-CHLOROMETHYLBENZALDEHYDE; >95%DISCONTINUED 10/25/01 Usage And Synthesis |
| Application | 4-(chloromethyl)benzaldehyde is an organic intermediate commonly used as a raw material in pharmaceutical synthesis. |
| | 4-CHLOROMETHYLBENZALDEHYDE; >95%DISCONTINUED 10/25/01 Preparation Products And Raw materials |
|