- POLY(D-LACTIDE)
-
- $1.10
-
2025-11-18
- CAS:106989-11-1
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- POLY(D-LACTIDE)
-
- $7.00
-
2020-02-12
- CAS:106989-11-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | POLY(D-LACTIDE) Basic information |
| Product Name: | POLY(D-LACTIDE) | | Synonyms: | D-polylactide / Poly(D-lactide);Propanoic acid, 2-hydroxy-, (2R)-, homopolymer;Poly(D-lactide),viscosity 1.75~2.25 dL/g;Poly(D-lactide),viscosity 2.25~3.00 dL/g;Poly(D-lactide),viscosity 3.00~4.25 dL/g;Poly(D-lactide),viscosity 4.25~6.00 dL/g;Poly(D-lactide),viscosity 6.00~8.25 dL/g;Poly(D-lactide),viscosity 8.25~11.25 dL/g | | CAS: | 106989-11-1 | | MF: | C3H6O3 | | MW: | 90.08 | | EINECS: | | | Product Categories: | | | Mol File: | 106989-11-1.mol |  |
| | POLY(D-LACTIDE) Chemical Properties |
| Melting point | 154 °C | | storage temp. | 2-8°C | | InChI | InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/s3 | | InChIKey | JVTAAEKCZFNVCJ-NVFNTWQMNA-N | | SMILES | [C@@H](O)(C)C(=O)O |&1:0,r| |
| WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| | POLY(D-LACTIDE) Usage And Synthesis |
| Uses | Poly(D-lactide) (PDLA), a polymer of a stereospecific cyclic di-ester of lactic acid, is used in biomaterial research for the development of devices such as therapeutic drug delivery vessels. Poly(D-lactide) is used for the preparation of microparticles and resorbable polylactide scaffolds. | | Definition | ChEBI: Methyl isobutyrate is the fatty acid methyl ester of isobutyric acid. It has a role as a metabolite. It is functionally related to an isobutyric acid. |
| | POLY(D-LACTIDE) Preparation Products And Raw materials |
|