| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:5-Sulfosalicylic acid hydrate
CAS:304851-84-1
Purity:95% Package:100G
|
| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:2-hydroxy-5-sulfobenzoic acid hydrate
CAS:304851-84-1
Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
|
| | 5-SULFOSALICYLIC ACID HYDRATE 95 Basic information |
| | 5-SULFOSALICYLIC ACID HYDRATE 95 Chemical Properties |
| form | solid | | InChI | 1S/C7H6O6S.H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;/h1-3,8H,(H,9,10)(H,11,12,13);1H2 | | InChIKey | PAUDQWJTTVPGHZ-UHFFFAOYSA-N | | SMILES | O.OC(=O)c1cc(ccc1O)S(O)(=O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-SULFOSALICYLIC ACID HYDRATE 95 Usage And Synthesis |
| Uses | 5-Sulfosalicylic acid hydrate can be used in the synthesis of hydrated complexes with benzotriazole, N, N′-dimethylpiperazine and N-methylpiperazine for the study of hydrogen bonding in supramolecular crystal structure. |
| | 5-SULFOSALICYLIC ACID HYDRATE 95 Preparation Products And Raw materials |
|