| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
Aromsyn Co., Ltd. |
| Tel: |
+86-0571-85585865 +86-13336024896 |
| Email: |
CB@aromsyn.com |
|
| | 2 5-Bis(hexyloxy)benzene-1 4-diacetonit& Basic information |
| | 2 5-Bis(hexyloxy)benzene-1 4-diacetonit& Chemical Properties |
| Melting point | 93.9-98.2 °C(lit.) | | InChI | 1S/C22H32N2O2/c1-3-5-7-9-15-25-21-17-20(12-14-24)22(18-19(21)11-13-23)26-16-10-8-6-4-2/h17-18H,3-12,15-16H2,1-2H3 | | InChIKey | GFPGEWHJZPFZMC-UHFFFAOYSA-N | | SMILES | CCCCCCOc1cc(CC#N)c(OCCCCCC)cc1CC#N |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2 5-Bis(hexyloxy)benzene-1 4-diacetonit& Usage And Synthesis |
| Uses | Monomeric precursor for the light-emitting polymer OC6C6-CN-PPV (or DHeO-CN-PPV) |
| | 2 5-Bis(hexyloxy)benzene-1 4-diacetonit& Preparation Products And Raw materials |
|