7-HYDROXY-4-PHENYLCOUMARIN 97 manufacturers
|
| | 7-HYDROXY-4-PHENYLCOUMARIN 97 Basic information |
| | 7-HYDROXY-4-PHENYLCOUMARIN 97 Chemical Properties |
| Melting point | 248-252 °C(lit.) | | form | solid | | InChI | 1S/C15H10O3/c16-11-6-7-12-13(10-4-2-1-3-5-10)9-15(17)18-14(12)8-11/h1-9,16H | | InChIKey | IVJMJRRORVMRJJ-UHFFFAOYSA-N | | SMILES | Oc1ccc2c(OC(=O)C=C2c3ccccc3)c1 |
| | 7-HYDROXY-4-PHENYLCOUMARIN 97 Usage And Synthesis |
| Uses | 7-Hydroxy-4-phenylcoumarin is a dual ALDH-2 and MAO inhibitor, with IC50 values of 1.5 and 0.5 μM, respectively[1]. | | References | [1] G Y Gao, et al. Synthesis of potential antidipsotropic isoflavones: inhibitors of the mitochondrial monoamine oxidase-aldehyde dehydrogenase pathway. J Med Chem. 2001 Sep 27;44(20):3320-8. DOI:10.1021/jm0101390 |
| | 7-HYDROXY-4-PHENYLCOUMARIN 97 Preparation Products And Raw materials |
|