- 2-ETHYNYLANILINE 98
-
- $7.00 / 1KG
-
2019-09-03
- CAS:52670-38-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: JD724
|
| | 2-Ethynylaniline Basic information |
| | 2-Ethynylaniline Chemical Properties |
| Melting point | 87-88 °C | | Boiling point | 229-230 °C (lit.) | | density | 1.030 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.6200(lit.) | | Fp | 209 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 1+-.0.10(Predicted) | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C8H7N/c1-2-7-5-3-4-6-8(7)9/h1,3-6H,9H2 | | InChIKey | ALQPJHSFIXARGX-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC=C1C#C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2921490090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Ethynylaniline Usage And Synthesis |
| Uses |
2-Ethynylaniline is an impurity of erlotinib.
|
| | 2-Ethynylaniline Preparation Products And Raw materials |
|