2-MORPHOLINOBENZONITRILE manufacturers
|
| | 2-MORPHOLINOBENZONITRILE Basic information |
| Product Name: | 2-MORPHOLINOBENZONITRILE | | Synonyms: | 4-(2-Cyanophenyl)morpholine;2-MORPHOLINOBENZONITRILE;2-(MORPHOLIN-4-YL)BENZONITRILE;Benzonitrile, 2-(4-morpholinyl)-;2-(4-morpholinyl) benzonitrile;2-(4-morpholinyl)benzenitrile | | CAS: | 204078-32-0 | | MF: | C11H12N2O | | MW: | 188.23 | | EINECS: | | | Product Categories: | | | Mol File: | 204078-32-0.mol |  |
| | 2-MORPHOLINOBENZONITRILE Chemical Properties |
| Boiling point | 357.4±37.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.13±0.40(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C11H12N2O/c12-9-10-3-1-2-4-11(10)13-5-7-14-8-6-13/h1-4H,5-8H2 | | InChIKey | KSUYFCSSOHFITQ-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC=C1N1CCOCC1 |
| Risk Statements | 20/22 | | Safety Statements | 36/37 | | HS Code | 29349990 |
| | 2-MORPHOLINOBENZONITRILE Usage And Synthesis |
| Chemical Properties | White crystal |
| | 2-MORPHOLINOBENZONITRILE Preparation Products And Raw materials |
|