| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
|
| | Wang-Yu non-directed C-H functionalization ligand Basic information |
| Product Name: | Wang-Yu non-directed C-H functionalization ligand | | Synonyms: | Wang-Yu non-directed C-H functionalization ligand;2(1H)-Pyridinone, 3,5-bis(trifluoromethyl)-;3,5-bis(trifluoromethyl)-2-hydroxypyridine;3,5-Bis(trifluoromethyl)pyridin-2-ol;3,5-Bis(trifluoromethyl)-2(1H)-pyridinone | | CAS: | 38609-76-6 | | MF: | C7H3F6NO | | MW: | 231.1 | | EINECS: | | | Product Categories: | | | Mol File: | 38609-76-6.mol |  |
| | Wang-Yu non-directed C-H functionalization ligand Chemical Properties |
| Melting point | 145 °C | | storage temp. | -20°C | | form | powder or crystals | | Appearance | White to off-white Solid | | InChIKey | IWSJDZMIJFAEBO-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1c(ncc(c1)C(F)(F)F)O |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | Wang-Yu non-directed C-H functionalization ligand Usage And Synthesis |
| Uses | This 2-pyridone ligand developed in the laboratory of Jin-Quan Yu binds to palladium and accelerates non-directed C-H functionalization. Developed for C-H olefination and carboxylation with arene as the limiting reagent, the Wang-Yu ligand enables diversification of drugs, synthetic intermediates, and other bioactive small molecules. | | reaction suitability | reaction type: C-C Bond Formation
reagent type: catalyst
reaction type: C-H Activation |
| | Wang-Yu non-directed C-H functionalization ligand Preparation Products And Raw materials |
|