|
|
| | 1,3,6,9,12-Pentaoxa-2-thiacyclotetradecane, 2,2-dioxide Basic information | | Uses |
| Product Name: | 1,3,6,9,12-Pentaoxa-2-thiacyclotetradecane, 2,2-dioxide | | Synonyms: | 1,3,6,9,12-Pentaoxa-2-thiacyclotetradecane, 2,2-dioxide | | CAS: | 1574267-61-0 | | MF: | C8H16O7S | | MW: | 256.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1574267-61-0.mol |  |
| | 1,3,6,9,12-Pentaoxa-2-thiacyclotetradecane, 2,2-dioxide Chemical Properties |
| Boiling point | 411.7±40.0 °C(Predicted) | | density | 1.219±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C8H16O7S/c9-16(10)14-7-5-12-3-1-11-2-4-13-6-8-15-16/h1-8H2 | | InChIKey | IJWLUNJQHVYRDR-UHFFFAOYSA-N | | SMILES | O1CCOCCOCCOCCOS1(=O)=O |
| | 1,3,6,9,12-Pentaoxa-2-thiacyclotetradecane, 2,2-dioxide Usage And Synthesis |
| Uses | 1,3,6,9,12-pentaoxa-2-thiacyclotetradecane 2,2-dioxide is commonly used as a crosslinking agent and functional monomer in organic synthesis for the preparation of polymer materials and biomedical materials. |
| | 1,3,6,9,12-Pentaoxa-2-thiacyclotetradecane, 2,2-dioxide Preparation Products And Raw materials |
|