| Company Name: |
ShangHai AmK Pharmaceutical Technology Co., Ltd.
|
| Tel: |
微信 17321281695 18019252918 |
| Email: |
sale@amkchem.com |
| Products Intro: |
Product Name:8-hydroxy-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid
CAS:26893-27-6
Purity:0.97 Package:1g,10g,100g
|
OXOLINIC ACID IMPURITY A manufacturers
- oxolinic acid impurity a
-
- $5.00 / 25kg
-
2024-04-23
- CAS:26893-27-6
- Min. Order: 1kg
- Purity: 99.92%
- Supply Ability: 50000tons
|
| | OXOLINIC ACID IMPURITY A Basic information |
| Product Name: | OXOLINIC ACID IMPURITY A | | Synonyms: | OXOLINIC ACID IMPURITY A;8-Hydroxy-1,3-dioxolo[4,5-g]quinoline-7-carboxylic acid;Sodium oxolinic;florfenicol Soluble;Oxolinic Acid EP Impurity A;1,3-Dioxolo[4,5-g]quinoline-7-carboxylic acid, 8-hydroxy-;8-Oxo-5,8-dihydro-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid | | CAS: | 26893-27-6 | | MF: | C11H7NO5 | | MW: | 233.18 | | EINECS: | 274-039-9 | | Product Categories: | | | Mol File: | Mol File |  |
| | OXOLINIC ACID IMPURITY A Chemical Properties |
| Melting point | >290 °C(Solv: N,N-dimethylformamide (68-12-2)) | | Boiling point | 459.2±45.0 °C(Predicted) | | density | 1.678±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 0.85±0.20(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C11H7NO5/c13-10-5-1-8-9(17-4-16-8)2-7(5)12-3-6(10)11(14)15/h1-3H,4H2,(H,12,13)(H,14,15) | | InChIKey | SNHCYVGJJIKKNG-UHFFFAOYSA-N | | SMILES | n1c2c(cc3c(c2)OCO3)c(c(c1)C(=O)O)O |
| | OXOLINIC ACID IMPURITY A Usage And Synthesis |
| Uses | Oxolinic acid impurity A EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. |
| | OXOLINIC ACID IMPURITY A Preparation Products And Raw materials |
|