|
|
| | Ethanediamide, N1-(2-methyl-1-naphthalenyl)-N2-(phenylmethyl)- Basic information |
| Product Name: | Ethanediamide, N1-(2-methyl-1-naphthalenyl)-N2-(phenylmethyl)- | | Synonyms: | Ethanediamide, N1-(2-methyl-1-naphthalenyl)-N2-(phenylmethyl)-;N1-?(2-?methyl-?1-?naphthalenyl)?-?N2-?(phenylmethyl)?- Ethanediamide;N1-Benzyl-N2-(2-methyl-1-naphthyl)oxalamide;Tenoxicam Impurity 14;N1-benzyl-N2-(2-methylnaphthalene-1-yl)amide;MNBO;N1-benzyl-N2-(2-methylnaphthalen-1-yl)oxalamide;N-benzyl-N'-(2-methylnaphthalen-1-yl)ethanediamide | | CAS: | 2072108-68-8 | | MF: | C20H18N2O2 | | MW: | 318.37 | | EINECS: | | | Product Categories: | | | Mol File: | 2072108-68-8.mol |  |
| | Ethanediamide, N1-(2-methyl-1-naphthalenyl)-N2-(phenylmethyl)- Chemical Properties |
| Melting point | 202-203°C | | density | 1.243±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 11.15±0.43(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | InChI=1S/C20H18N2O2/c1-14-11-12-16-9-5-6-10-17(16)18(14)22-20(24)19(23)21-13-15-7-3-2-4-8-15/h2-12H,13H2,1H3,(H,21,23)(H,22,24) | | InChIKey | QOOOSPCWFVCKFK-UHFFFAOYSA-N | | SMILES | C(NC1=C2C(C=CC=C2)=CC=C1C)(=O)C(NCC1=CC=CC=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ethanediamide, N1-(2-methyl-1-naphthalenyl)-N2-(phenylmethyl)- Usage And Synthesis |
| Uses | MNBO is a ligand for the copper-catalyzed Ullman-Ma cross-coupling reaction. |
| | Ethanediamide, N1-(2-methyl-1-naphthalenyl)-N2-(phenylmethyl)- Preparation Products And Raw materials |
|