| Company Name: |
Binhai gill polypeptide co. LTD
|
| Tel: |
021-61263389 13524856427 |
| Email: |
Joetang@glschina.com |
| Products Intro: |
CAS:453556-65-5 Purity:98% Package:4g
|
| Company Name: |
Shanghai Galedo Biotechnology Co., Ltd.
|
| Tel: |
021-61732478 19946252459 |
| Email: |
sales@galedo-bio.com |
| Products Intro: |
Product Name:Boc-L-5,5,5-trifluoroNorvaline CAS:453556-65-5 Purity:98% HPLC Package:5KG;1KG
|
| Company Name: |
Shanghai Haohong Pharmaceutical Co., Ltd.
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:(S)-2-((tert-Butoxycarbonyl)amino)-5,5,5-trifluoropentanoic acid CAS:453556-65-5 Purity:97%
|
|
| | L-Norvaline, N-[(1,1-dimethylethoxy)carbonyl]-5,5,5-trifluoro- Basic information |
| Product Name: | L-Norvaline, N-[(1,1-dimethylethoxy)carbonyl]-5,5,5-trifluoro- | | Synonyms: | L-Norvaline, N-[(1,1-dimethylethoxy)carbonyl]-5,5,5-trifluoro-;(2S)-2-{[(tert-butoxy)carbonyl]amino}-5,5,5-trifluoropentanoic acid;Boc-L-5,5,5-trifluoroNorvaline;(S)-2-((tert-Butoxycarbonyl)amino)-5,5,5-trifluoropentanoic acid - [B91633];N-Boc-5,5,5-trifluoro-L-norvaline;(S)-Boc-2-amino-5,5,5-trifluoropentanoic acid | | CAS: | 453556-65-5 | | MF: | C10H16F3NO4 | | MW: | 271.23 | | EINECS: | | | Product Categories: | | | Mol File: | 453556-65-5.mol | ![L-Norvaline, N-[(1,1-dimethylethoxy)carbonyl]-5,5,5-trifluoro- Structure](CAS/20210111/GIF/453556-65-5.gif) |
| | L-Norvaline, N-[(1,1-dimethylethoxy)carbonyl]-5,5,5-trifluoro- Chemical Properties |
| Melting point | 67-68 °C | | Boiling point | 341.3±42.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.76±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H16F3NO4/c1-9(2,3)18-8(17)14-6(7(15)16)4-5-10(11,12)13/h6H,4-5H2,1-3H3,(H,14,17)(H,15,16)/t6-/m0/s1 | | InChIKey | YRXRZBPEGLIKRH-LURJTMIESA-N | | SMILES | C(O)(=O)[C@H](CCC(F)(F)F)NC(OC(C)(C)C)=O |
| | L-Norvaline, N-[(1,1-dimethylethoxy)carbonyl]-5,5,5-trifluoro- Usage And Synthesis |
| | L-Norvaline, N-[(1,1-dimethylethoxy)carbonyl]-5,5,5-trifluoro- Preparation Products And Raw materials |
|