|
|
| | TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)YTTRIUM(III) Basic information |
| Product Name: | TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)YTTRIUM(III) | | Synonyms: | TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)YTTRIUM;TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)YTTRIUM(III);YTTRIUM TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE);YTTRIUM TRIS (DIPIVALOYLMETHANATE);YTTRIUM(III) TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE);YTTRIUM(III) THD;YTTRIUM(III) DPM;Y(TMHD)3 | | CAS: | 15632-39-0 | | MF: | C33H57O6Y | | MW: | 638.71 | | EINECS: | | | Product Categories: | metal beta-diketonate complexes;ALD Precursors | | Mol File: | 15632-39-0.mol |  |
| | TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)YTTRIUM(III) Chemical Properties |
| Melting point | 173-175 °C(lit.) | | Boiling point | 290°C | | Fp | 95°C/0.05mm | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | white to off-white | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Sensitive | Hygroscopic | | InChI | InChI=1S/3C11H20O2.Y/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b3*8-7-; | | InChIKey | PPRRRPCEDUWEHL-LWTKGLMZSA-K | | SMILES | C(C)(C)(C)/C(/O[Y](O/C(=C\C(=O)C(C)(C)C)/C(C)(C)C)O/C(=C\C(=O)C(C)(C)C)/C(C)(C)C)=C/C(=O)C(C)(C)C | | CAS DataBase Reference | 15632-39-0 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)YTTRIUM(III) Usage And Synthesis |
| Chemical Properties | white crystals | | Uses | A precursor for the formation of thin films of yttria by CECVD. The films have potential applications as electronic insulators, coatings, reaction barriers and superconducting materials. | | reaction suitability | core: yttrium reagent type: catalyst |
| | TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)YTTRIUM(III) Preparation Products And Raw materials |
|