- (E)-β-Farnesene
-
- $40.00
-
2026-06-16
- CAS:18794-84-8
- Purity: 98.00%
- Supply Ability: 10g
- (E)-BETA-FARNESENE
-
- $6.00
-
2025-07-29
- CAS:18794-84-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000KG/Month
|
| | (E)-BETA-FARNESENE Basic information |
| Product Name: | (E)-BETA-FARNESENE | | Synonyms: | 7,11-dimethyl-3-methylene-(e)-10-dodecatriene;7,11-Dimethyl-3-methylene-1,6,10-dodecatriene;beta-farnesene (E);beta-trans-Farnesene;Farnesene (E, beta);t-.beta.-farnesene;(E)-7,11-dimethyl-3-methylenedodeca-1,6,10-triene;β-farnesene,(E)-7,11-dimethyl-3-methylene-1,6,10-dodecatriene,(E)-β-farnesene | | CAS: | 18794-84-8 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | 242-582-0 | | Product Categories: | | | Mol File: | 18794-84-8.mol |  |
| | (E)-BETA-FARNESENE Chemical Properties |
| Melting point | <25℃ | | Boiling point | 272.5±20.0℃ (760 Torr) | | density | 0.807±0.06 g/cm3 (20 ºC 760 Torr) | | vapor pressure | 34Pa at 25℃ | | refractive index | 1.487 (589.3 nm 18℃) | | FEMA | 3839 | ALPHA-FARNESENE | | Fp | 110 °C | | storage temp. | −20°C | | solubility | Chloroform (Slightly), Dichloromethane (Slightly) | | form | Liquid | | color | Colourless | | Odor | at 100.00 %. woody citrus herbal sweet | | Odor Type | woody | | Water Solubility | 100μg/L at 20℃ | | JECFA Number | 1343 | | Major Application | food and beverages | | Cosmetics Ingredients Functions | FRAGRANCE PERFUMING | | InChI | 1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9,12H,1,4,7-8,10-11H2,2-3,5H3/b15-12+ | | InChIKey | JSNRRGGBADWTMC-NTCAYCPXSA-N | | SMILES | [H]\C(CCC(=C)C=C)=C(\C)CC\C=C(\C)C | | LogP | 6.5 at 30℃ | | EPA Substance Registry System | (E)-.beta.-Farnesene (18794-84-8) |
| Hazard Codes | Xi | | Risk Statements | 38 | | WGK Germany | 3 | | F | 10-23 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Asp. Tox. 1 |
| | (E)-BETA-FARNESENE Usage And Synthesis |
| Chemical Properties | water ≤0.04% colorless to faint-yellow | | Uses | trans-β-Farnesene is a sesquiterpene natural product made my different plants to repel pest aphid species. | | Definition | ChEBI: A beta-farnesene in which the double bond at position 6-7 has E configuration. It is the major or sole alarm pheromone in most species of aphid. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 48, p. 5183, 1983 DOI: 10.1021/jo00174a007 Tetrahedron Letters, 25, p. 5193, 1984 DOI: 10.1016/S0040-4039(01)81561-6 | | in vivo | (E)-β-Farnesene (0.01-100 μM, soaked in cotton balls, 24-30 h) stimulates feeding in both male and female Lutzomyia longipalpis Lutz & Neiva[1].
|
| | (E)-BETA-FARNESENE Preparation Products And Raw materials |
| Raw materials | trans-nerolidol-->4,9-Decadienal, 4-methyl-8-methylene-, (4E)--->trichodiene-->2,6,10-Dodecatriene, 1-methoxy-3,7,11-trimethyl-, (2E,6E)--->(Z,E)-ALPHA-FARNESENE-->FARNESENE-->1-Methyl-1-nitrosourea-->1,3-Cyclohexadiene, 1-(1,5-dimethyl-4-hexen-1-yl)-4-methyl--->1,3-Cyclohexadiene, 5-(1,5-dimethyl-4-hexen-1-yl)-2-methyl--->beta-curcumene-->(+)-7-epi-sesquithujene-->Cyclohexene, 4-(1,5-dimethyl-4-hexen-1-ylidene)-1-methyl-, (4E)- | | Preparation Products | (5E,9E)-6,10,14-Trimethylpentadeca-5,9,13-trien-2-one |
|