|
|
| | S-(Trifluoromethyl)dibenzothiophenium trifluoromethanesulfonate Basic information |
| | S-(Trifluoromethyl)dibenzothiophenium trifluoromethanesulfonate Chemical Properties |
| Melting point | 155 °C | | density | 7 g/cm3 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Water (Slightly, Heated) | | form | Crystalline Powder | | color | White to tan | | InChI | InChI=1S/C13H8F3S.CHF3O3S/c14-13(15,16)17-11-7-3-1-5-9(11)10-6-2-4-8-12(10)17;2-1(3,4)8(5,6)7/h1-8H;(H,5,6,7)/q+1;/p-1 | | InChIKey | QXXHXTRTGZBOGD-UHFFFAOYSA-M | | SMILES | C12C=CC=CC=1C1=C(C=CC=C1)[S+]2C(F)(F)F.C(F)(F)(F)S([O-])(=O)=O | | CAS DataBase Reference | 129946-88-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | S-(Trifluoromethyl)dibenzothiophenium trifluoromethanesulfonate Usage And Synthesis |
| Chemical Properties | S-(Trifluoromethyl)dibenzothiophenium trifluoromethanesulfonate is white to pale brown crystalline powder | | Uses | S-(Trifluoromethyl)dibenzothiophenium trifluoromethanesulfonate. Electrophilic trifluoromethylation in ionic liquids. Used in the stereoselective preparation of trifluoromethylalkynes by trifluoromethylation of terminal alkynes using Umemoto′s reagent and a copper catalyst. | | Uses | 5-(Trifluoromethyl)dibenzothiophenium 1,1,1-Trifluoromethanesulfonate is used in the synthesis of substituted isoxazolines. Also used in the synthesis of β-ketophosphonate derivatives as building blocks in automated syntheses. | | storage | nonhygroscopic and thermally stable crystals; should be stored in a dry
atmosphere protected from light. |
| | S-(Trifluoromethyl)dibenzothiophenium trifluoromethanesulfonate Preparation Products And Raw materials |
|