|
|
| | 1-INDANOL Basic information |
| Product Name: | 1-INDANOL | | Synonyms: | 1-Indanol, 98% 10GR;1-Hydroxyhydrindene
1-Indanol;1-Indanol 98%;INDAN-1-OL;AURORA KA-6964;(±)-2,3-dihydro-1H-inden-1-ol;1-Indanole;2,3-Dihydro-1H-inden-1-ol | | CAS: | 6351-10-6 | | MF: | C9H10O | | MW: | 134.18 | | EINECS: | 228-755-3 | | Product Categories: | pharmacetical | | Mol File: | 6351-10-6.mol |  |
| | 1-INDANOL Chemical Properties |
| Melting point | 50-53 °C | | Boiling point | 128 °C12 mm Hg(lit.) | | density | 0.8540 (rough estimate) | | refractive index | 1.5630 (estimate) | | Fp | 145 °C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pKa | 14.23±0.20(Predicted) | | form | Crystalline Solid | | color | White to slightly yellow | | Water Solubility | Soluble in water 10 g/L at 20°C, ethanol, benzene. | | BRN | 2042960 | | InChI | InChI=1S/C9H10O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-10H,5-6H2 | | InChIKey | YIAPLDFPUUJILH-UHFFFAOYSA-N | | SMILES | C1(O)C2=C(C=CC=C2)CC1 | | CAS DataBase Reference | 6351-10-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | NK7300000 | | Hazard Note | Irritant | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29062990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-INDANOL Usage And Synthesis |
| Chemical Properties | white to slightly yellow crystalline solid | | Uses | 1-Indanol derivative was found to be an efficient ligand for the palladium-catalyzed asymmetric Heck reaction. It is used as pharmaceutical intermediate. | | Definition | ChEBI: Indan-1-ol is a member of indanes, an aromatic alcohol and a secondary alcohol. It has a role as a xenobiotic. It derives from a hydride of an indane. | | General Description | Chiral-sensitive aggregation of 1-indanol has been studied by FTIR spectroscopy. Transfer dehydrogenation of 1-indanol has been investigated over heterogeneous palladium catalyst using cyclohexene as hydrogen acceptor. |
| | 1-INDANOL Preparation Products And Raw materials |
|