HFPO dimer, acid fluoride manufacturers
|
| | HFPO dimer, acid fluoride Basic information | | Uses |
| Product Name: | HFPO dimer, acid fluoride | | Synonyms: | 2-(HEPTAFLUOROPROPOXY)TETRAFLUOROPROPIONYL FLUORIDE;HEXAFLUOROPROPENE OXIDE DIMER;2-(Heptafluoropropoxy)-2,3,3,3-tetrafluoropropionyl fluoride;2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propionyl fluoride;2-(HEPTAFLUOROPROPOXY)TETRAFLUOROPROPIONYL FLUORIDE 96+%;HFPOdimer,acidfluoride;UNDECAFLUORO-(2-METHYL-3-OXAHEXANOYL) FLUORIDE;2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)-propanoylfluorid | | CAS: | 2062-98-8 | | MF: | C6F12O2 | | MW: | 332.04 | | EINECS: | 218-173-8 | | Product Categories: | | | Mol File: | 2062-98-8.mol |  |
| | HFPO dimer, acid fluoride Chemical Properties |
| Boiling point | 54-56°C | | density | 1.61 | | refractive index | 1.300 | | Fp | 54-56°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | color | Clear, colourless | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C6F12O2/c7-1(19)2(8,4(11,12)13)20-6(17,18)3(9,10)5(14,15)16 | | InChIKey | BCLQALQSEBVVAD-UHFFFAOYSA-N | | SMILES | C(F)(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 2062-98-8(CAS DataBase Reference) | | EPA Substance Registry System | Propanoyl fluoride, 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)- (2062-98-8) |
| Hazard Codes | C | | Risk Statements | 34-37 | | Safety Statements | 23-26-36/37/39-45 | | RIDADR | 3265 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2934999090 |
| Provider | Language |
|
ALFA
| English |
| | HFPO dimer, acid fluoride Usage And Synthesis |
| Uses | Perfluorinated (2-methyl-3-oxahexyl) fluorides can be used to synthesize fluorinated surfactants and intermediates for fluorinated resins. |
| | HFPO dimer, acid fluoride Preparation Products And Raw materials |
|