1-CYCLOPROPYLETHANOL manufacturers
- 1-Cyclopropylethanol
-
- $8.80 / 1kg
-
2025-10-13
- CAS:765-42-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | 1-CYCLOPROPYLETHANOL Basic information |
| | 1-CYCLOPROPYLETHANOL Chemical Properties |
| Melting point | -32.1°C | | Boiling point | 120-122 °C(lit.) | | density | 0.881 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.431(lit.) | | Fp | 87 °F | | storage temp. | Flammables area | | pka | 15.17±0.20(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 1839704 | | InChI | InChI=1S/C5H10O/c1-4(6)5-2-3-5/h4-6H,2-3H2,1H3 | | InChIKey | DKKVKJZXOBFLRY-UHFFFAOYSA-N | | SMILES | C(C1CC1)(O)C | | CAS DataBase Reference | 765-42-4(CAS DataBase Reference) | | EPA Substance Registry System | Cyclopropanemethanol, .alpha.-methyl- (765-42-4) |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 1987 3/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29061990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 1-CYCLOPROPYLETHANOL Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID |
| | 1-CYCLOPROPYLETHANOL Preparation Products And Raw materials |
|