| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | PAROXETINE-D6 MALEATE Basic information |
| Product Name: | PAROXETINE-D6 MALEATE | | Synonyms: | PAROXETINE-D6 MALEATE;Paroxetine-D6 maleate solution;Paroxetine-D;PAROXETINE MALEATE-D6;(-)-(3S,4R)-Paroxetine-d6 maleate (methylene-d2, alpha-N-piperazine-d4);Paroxetine-D6 maleate solutionQ: What is
Paroxetine-D6 maleate solution Q: What is the CAS Number of
Paroxetine-D6 maleate solution;(-)-(3S,4R)-Paroxetine-d6 maleate (methylene-d2, alpha-N-piperazine-d4) in methanol;Paroxetine-D6 maleate solution | | CAS: | 1435728-64-5 | | MF: | C23H24FNO7 | | MW: | 445.44 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | PAROXETINE-D6 MALEATE Chemical Properties |
| Fp | 9 °C | | storage temp. | -20°C | | form | liquid | | Major Application | clinical testing | | InChIKey | AEIUZSKXSWGSRU-VPMYKUOPSA-N | | SMILES | OC(=O)\C=C/C(O)=O.[2H]C1([2H])C[C@H]([C@@H](C([2H])([2H])N1)C([2H])([2H])Oc2ccc3OCOc3c2)c4ccc(F)cc4 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | PAROXETINE-D6 MALEATE Usage And Synthesis |
| Uses | clinical testing | | General Description | Paroxetine, marketed under trade names Paxil and Aropax, is an SSRI antidepressant used to treat many conditions in adults from major depression and obsessive-compulsive disorder to several anxiety disorders. This stable-labeled internal standard is suitable for quantification of paroxetine using LC/MS or LC-MS/MS methods for applications in clinical or diagnostic testing, clinical toxicology, or pharmaceutical research. |
| | PAROXETINE-D6 MALEATE Preparation Products And Raw materials |
|