|
|
| | 2,4-Dichloro-5-fluorobenzoyl chloride Basic information | | Uses |
| Product Name: | 2,4-Dichloro-5-fluorobenzoyl chloride | | Synonyms: | 2,4-DICHLORO-5-FLUOROBENZOYL CHLORIDE;2,4-Dichloro-5-Fluorosbenzoylchloride;2,4-difluoro-5-fluorobenzoyl chloride;2,4-Dichloro-5-fluorobenzoyl chloride 98%;2,4-Dichloro-5-fluorobenzoylchloride98%;5-FLUORO2,4-DICHLOROBENZOYLCHLORIDE;2,4-Dichlor-5-fluor-benzoylchlorid;2,4-DICHLORO-5-FLUOROBENZOYL CHLORIDE, 9 6% | | CAS: | 86393-34-2 | | MF: | C7H2Cl3FO | | MW: | 227.45 | | EINECS: | 428-390-1 | | Product Categories: | Fluorine series;Acid Halides;Carbonyl Compounds;Organic Building Blocks;Chlorobenzene Series | | Mol File: | 86393-34-2.mol |  |
| | 2,4-Dichloro-5-fluorobenzoyl chloride Chemical Properties |
| Boiling point | 143-144 °C35 mm Hg(lit.) | | density | 1.568 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.572(lit.) | | Fp | >230 °F | | storage temp. | RT, stored under nitrogen | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.568 | | Sensitive | Moisture Sensitive | | BRN | 4989077 | | InChI | InChI=1S/C7H2Cl3FO/c8-4-2-5(9)6(11)1-3(4)7(10)12/h1-2H | | InChIKey | RPZXUSJCSDQNTE-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=CC(F)=C(Cl)C=C1Cl | | CAS DataBase Reference | 86393-34-2(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 1 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2916399090 |
| | 2,4-Dichloro-5-fluorobenzoyl chloride Usage And Synthesis |
| Uses | 2,4-Dichloro-5-fluorobenzoyl chloride is a major raw material for the preparation of antipsychotic drugs trifluoroguanidine alcohol, trifluoroguanidine, pentafluorolido, and the synthesis of broad-spectrum antibiotics such as ciprofloxacin and other third-generation quinolone drugs. It can also be used in pesticides, insecticides, ovicides, and the identification of plastics and resins. | | Chemical Properties | Colorless transparent liquid |
| | 2,4-Dichloro-5-fluorobenzoyl chloride Preparation Products And Raw materials |
|