- Glutacondianil hydrochloride
-
- $0.00 / 1kg
-
2026-01-04
- CAS:1497-49-0
- Min. Order: 0.10000000149011612kg
- Purity: 99.0%min
- Supply Ability: 20000kg
|
| | Glutacondianil hydrochloride Basic information |
| Product Name: | Glutacondianil hydrochloride | | Synonyms: | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-oxolanyl]-7-methyl-8-sulfanylidene-3H-purin-6-one;Pentadienal diethylene aniline hydrochloride;N-((2E,4E)-5-(Phenylamino)penta-2,4-dien-1-ylidene)aniline hydrochloride;N-[5-(Phenylamino)-2,4-pentadienylidene]aniline hydrochloride;N-[5-(PHENYLAMINO)-2,4-PENTADIENYLIDENE]ANILINE MONOHYDROCHLORIDE;N-(5-ANILINO-2,4-PENTADIENYLIDENE)ANILINE HCL SALT;N-(5-ANILINO-2,4-PENTADIENYLIDENE)ANILINE HYDROCHLORIDE;n-[5-(phenylamino)-2,4-pentadienylidene]-benzenaminmonohydrochloride | | CAS: | 1497-49-0 | | MF: | C17H17ClN2 | | MW: | 284.78 | | EINECS: | 216-094-3 | | Product Categories: | P;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 1497-49-0.mol |  |
| | Glutacondianil hydrochloride Chemical Properties |
| Melting point | 152 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Powder | | color | Bordeaux to purple | | Water Solubility | Soluble in methanol. Insoluble in water.. | | Sensitive | Hygroscopic | | BRN | 3916924 | | Stability: | Hygroscopic | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | InChI=1S/C17H16N2.ClH/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17;/h1-15,18H;1H/b9-3+,14-8+,19-15+; | | InChIKey | VUCMMJBDNXZQDJ-SAIFEKGMSA-N | | SMILES | C1(N/C=C/C=C/C=N/C2C=CC=CC=2)C=CC=CC=1.Cl | | CAS DataBase Reference | 1497-49-0(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, N-[5-(phenylamino)-2,4-pentadienylidene]-, monohydrochloride (1497-49-0) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 36/37/39-26-37/39-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29214200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Glutacondianil hydrochloride Usage And Synthesis |
| Chemical Properties | bordeaux to purple powder | | Uses | Glutacondianil Hydrochloride is used as a reagent in the synthesis of novel vinylsulfone cyanine dyes used for labelling biomolecules. Dyes and metabolites. |
| | Glutacondianil hydrochloride Preparation Products And Raw materials |
|