|
|
| | 2-Iodylbenzoic acid Basic information |
| Product Name: | 2-Iodylbenzoic acid | | Synonyms: | STABILIZED IBX;2-iodylbenzoic acid;O-IODOXYBENZOIC ACID, 97%;BENZOIC ACID, 2-IODYL-;2-Carboxyphenyliodine(V)dioxide;2-(iodooxy)benzoic acid;ortho-iodylbenzoic acid;Benzoicacid, o-iodoxy- (6CI) | | CAS: | 64297-64-9 | | MF: | C7H5IO4 | | MW: | 280.02 | | EINECS: | 264-773-8 | | Product Categories: | | | Mol File: | 64297-64-9.mol |  |
| | 2-Iodylbenzoic acid Chemical Properties |
| Melting point | 280 °C | | Boiling point | 153 °C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | 2+-.0.36(Predicted) | | form | Powder, Prills or Agglomerates | | color | White to off-white | | InChI | InChI=1S/C7H5IO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10) | | InChIKey | FIYYMXYOBLWYQO-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1I(=O)=O |
| Provider | Language |
|
ACROS
| English |
| | 2-Iodylbenzoic acid Usage And Synthesis |
| Uses | 2-Iodylbenzoic Acid is used in the oxidation of primary and secondary alcohols to aldehydes and ketones and for the oxidation of 1,2-diols to alpha-ketols and alpha-diketones. A useful reagent for the oxidation of N-protected β-amino alcohols. | | Definition | ChEBI: A benzoic acid compound having an iodyl substituent at the ortho-position. | | Synthesis | 2-Iodoylbenzoic acid is prepared from o-iodobenzoic acid, potassium bromate (or potassium peroxymonosulfate complex salt) and sulfuric acid. |
| | 2-Iodylbenzoic acid Preparation Products And Raw materials |
|