|
| 2-Diphenylphosphinobenzaldehyde Basic information |
| 2-Diphenylphosphinobenzaldehyde Chemical Properties |
Melting point | 112-115 °C(lit.) | Boiling point | 417.4±28.0 °C(Predicted) | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | form | Crystalline Powder | color | Yellow | λmax | 376nm(CH2Cl2)(lit.) | InChI | InChI=1S/C19H15OP/c20-15-16-9-7-8-14-19(16)21(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-15H | InChIKey | DRCPJRZHAJMWOU-UHFFFAOYSA-N | SMILES | C(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 | CAS DataBase Reference | 50777-76-9(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-37/39 | WGK Germany | 3 | HS Code | 29310099 |
| 2-Diphenylphosphinobenzaldehyde Usage And Synthesis |
Uses | suzuki reaction | Synthesis Reference(s) | Synthetic Communications, 22, p. 1453, 1992 DOI: 10.1080/00397919208021613 | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| 2-Diphenylphosphinobenzaldehyde Preparation Products And Raw materials |
|