| Company Name: |
NanTong Chemistar Chemical Co.,Ltd Gold
|
| Tel: |
025-52643182 13914798241 |
| Email: |
doria@chemipioneer.com.cn |
| Products Intro: |
Product Name:1-(2-bromoethyl)-4-octylbenzene CAS:268557-54-6 Purity:99% Package:100g/;1kg/;1T/
|
| Company Name: |
Nanjing Chemipioneer Pharma& Tech Co., LTD Gold
|
| Tel: |
025-52643182 13914798241 |
| Email: |
zhoulq@chemipioneer.com.cn |
| Products Intro: |
Product Name:1-(2-bromoethyl)-4-octylbenzene CAS:268557-54-6 Purity:99 Package:100g/;1kg/;1T/
|
| Company Name: |
Shanghai Yanze Chemical Co., Ltd.
|
| Tel: |
13773155751 15345144255 |
| Email: |
260924549@qq.com |
| Products Intro: |
Product Name:1-(2-bromoethyl)-4-octylbenzene CAS:268557-54-6 Purity:99%HPLC Package:100kg;25kg;10kg;5kg;1kg
|
|
| | 1-(2-bromoethyl)-4-octylbenzene Basic information |
| | 1-(2-bromoethyl)-4-octylbenzene Chemical Properties |
| Boiling point | 346.3±11.0 °C(Predicted) | | density | 1.112±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C16H25Br/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)13-14-17/h9-12H,2-8,13-14H2,1H3 | | InChIKey | PLDICAWLDKZBFW-UHFFFAOYSA-N | | SMILES | C1(CCBr)=CC=C(CCCCCCCC)C=C1 |
| | 1-(2-bromoethyl)-4-octylbenzene Usage And Synthesis |
| Uses | 2-(4-Octylphenyl)ethyl Bromide is a reagent used in the synthesis of N-substituted iminosugar derivatives for their immunosuppressive activities. |
| | 1-(2-bromoethyl)-4-octylbenzene Preparation Products And Raw materials |
|