|
|
| | 9-(2-CARBOXY-2-CYANOVINYL)JULOLIDINE Basic information |
| Product Name: | 9-(2-CARBOXY-2-CYANOVINYL)JULOLIDINE | | Synonyms: | 9-(2-CARBOXY-2-CYANOVINYL)JULOLIDINE;9-((E)-2-carboxy-2-cyanovinyl)*julolidine;9-((E)-2-CARBOXY-2-CYANOVINYL) &;9-[(2-Cyano-2-hydroxycarbonyl)-vinyl]-julolidine;-(2-CARBOXY-2-CYANOVINYL)JULOLIDINE;1,5-dihydropyrido[3,2,1-ij]quinoline acrylate;(2Z)-2-Cyano-3-(2,3,6,7-tetrahydro-1H,5H-pyrido[3,2,1-ij]quinolin-9-yl)acrylic acid;CCVJ [9-(2-Carboxy-2-cyanovinyl)julolidine] | | CAS: | 142978-18-5 | | MF: | C16H16N2O2 | | MW: | 268.31 | | EINECS: | | | Product Categories: | | | Mol File: | 142978-18-5.mol |  |
| | 9-(2-CARBOXY-2-CYANOVINYL)JULOLIDINE Chemical Properties |
| Boiling point | 539.4±50.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble | | form | A crystalline solid | | pka | 0.96±0.19(Predicted) | | color | Orange to red | | Appearance | Solid Powder | | InChI | 1S/C16H16N2O2/c17-10-14(16(19)20)9-11-7-12-3-1-5-18-6-2-4-13(8-11)15(12)18/h7-9H,1-6H2,(H,19,20)/b14-9+ | | InChIKey | JXENNHTVELFRHV-NTEUORMPSA-N | | SMILES | OC(=O)\C(=C\c1cc2CCCN3CCCc(c1)c23)C#N |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 9-(2-CARBOXY-2-CYANOVINYL)JULOLIDINE Usage And Synthesis |
| Description | CCVJ is a fluorescent probe for binding to proteins. It is a molecular rotor characterized by low background fluorescence, low fluorescence anisotropy, and good water solubility. | | Uses | 9-(2-Carboxy-2-cyanovinyl)julolidine is a fluorescent probe for binding to proteins. It is a fluorescent molecular rotor used in the study of G-F transformation of actin. |
| | 9-(2-CARBOXY-2-CYANOVINYL)JULOLIDINE Preparation Products And Raw materials |
|