- PD 151746
-
- $35.00
-
2026-06-12
- CAS:179461-52-0
- Purity: 99.04%
- Supply Ability: 10g
|
| | PD 151746 Basic information |
| Product Name: | PD 151746 | | Synonyms: | 3-(5-FLUORO-3-INDOLYL)-2-MERCAPTO-(Z)-2-PROPENOIC ACID;PD 151746;PD 151746 - CAS 179461-52-0 - Calbiochem;PD-151746;PD 151746;PD151746;CS-1888;3-(5-fluoro-1H-indol-3-yl)-2-mercapto-2-propenoic acid;PD151746 3-(5-fluoro-1H-indol-3-yl)-2-mercapto-2-Propenoic acid;PD 151746, 96%, cell permeable, selective, calpain inhibitor | | CAS: | 179461-52-0 | | MF: | C11H8FNO2S | | MW: | 237.25 | | EINECS: | | | Product Categories: | Inhibitors | | Mol File: | Mol File |  |
| | PD 151746 Chemical Properties |
| Boiling point | 481.4±45.0 °C(Predicted) | | density | 1.525±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: soluble15mg/mL (clear orange solution) | | pka | 3.19±0.19(Predicted) | | form | powder | | color | light orange to dark orange | | InChI | InChI=1S/C11H8FNO2S/c12-7-1-2-9-8(4-7)6(5-13-9)3-10(16)11(14)15/h1-5,13,16H,(H,14,15) | | InChIKey | HWMQHECFXSVZGN-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(S)=CC1C2=C(NC=1)C=CC(F)=C2 |
| Safety Statements | 24/25 | | RIDADR | 3077 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | PD 151746 Usage And Synthesis |
| Uses | PD 151746 acts as a cell-permeable calpain inhibitor which induce pertussis toxin (PTx)-sensitive chemotaxis in neutrophils and human monocytes. This results in an inhibition of inflammation. | | Biological Activity | Primary Target calpain-1', 'Target Ki: 260 nM against calpain-1 |
| | PD 151746 Preparation Products And Raw materials |
|