|
| 2-BENZYLOXY-1,3-PROPANEDIOL Basic information |
| 2-BENZYLOXY-1,3-PROPANEDIOL Chemical Properties |
Melting point | 38-40 °C (lit.) | Boiling point | 185-187 °C/10 mmHg (lit.) | density | 1.160 | refractive index | 1.4880 (estimate) | Fp | >230 °F | storage temp. | Sealed in dry,Room Temperature | solubility | Chloroform (Sparingly), Methanol (Slightly) | pka | 13.91±0.10(Predicted) | form | Solid | color | Off-White | BRN | 1953926 | InChI | InChI=1S/C10H14O3/c11-6-10(7-12)13-8-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 | InChIKey | UDIPIOHLDFSMLR-UHFFFAOYSA-N | SMILES | C(O)C(OCC1=CC=CC=C1)CO |
Safety Statements | 22-24/25 | WGK Germany | 3 | RTECS | TY3181000 | HS Code | 2909498090 | Toxicity | mouse,LD50,intraperitoneal,2300mg/kg (2300mg/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 105, Pg. 450, 1952. |
| 2-BENZYLOXY-1,3-PROPANEDIOL Usage And Synthesis |
Uses | 2-BENZYLOXY-1,3-PROPANEDIOL is a gylcerol derivative used in the preparation of glycerides and their phosphonate analogs as potent inhibitors of lipase. |
| 2-BENZYLOXY-1,3-PROPANEDIOL Preparation Products And Raw materials |
|