|
|
| | 1,2-BENZENEDIMETHANETHIOL Basic information |
| | 1,2-BENZENEDIMETHANETHIOL Chemical Properties |
| Melting point | 43-45 °C (lit.) | | Boiling point | 160 °C/20 mmHg (lit.) | | density | 1.1604 (rough estimate) | | refractive index | 1.6210 (estimate) | | Fp | >230 °F | | InChI | InChI=1S/C8H10S2/c1-9-7-5-3-4-6-8(7)10-2/h3-6H,1-2H3 | | InChIKey | KMGHCDZLSCNMDC-UHFFFAOYSA-N | | SMILES | C1(SC)=CC=CC=C1SC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | UN 3335 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2-BENZENEDIMETHANETHIOL Usage And Synthesis |
| Uses | 1,2-Benzenedimethanethiol was used to stabilize lead sulfide (PbS) quantum dots. It was also used in the synthesis of 1,3-dihydrobenzo[c]thiophene. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 48, p. 3114, 1983 DOI: 10.1021/jo00166a040 |
| | 1,2-BENZENEDIMETHANETHIOL Preparation Products And Raw materials |
|