| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4-Dimethylbenzenesulfonyl chloride Basic information |
| Product Name: | 2,4-Dimethylbenzenesulfonyl chloride | | Synonyms: | ART-CHEM-BB B019390;CHEMBRDG-BB 4009794;2,4-DIMETHYLBENZENESULFONYL CHLORIDE;AKOS BBS-00000860;AKOS B019390;2,4-Dimethylbenzene-1-sulfonyl chloride;2,4-Dimethyl-1-benzenesulfonyl chloride;2,4-dimethylbenzenesulfonyl chloride(SALTDATA: FREE) | | CAS: | 609-60-9 | | MF: | C8H9ClO2S | | MW: | 204.67 | | EINECS: | | | Product Categories: | | | Mol File: | 609-60-9.mol |  |
| | 2,4-Dimethylbenzenesulfonyl chloride Chemical Properties |
| Melting point | 28-33 °C | | Boiling point | 82°C/0.4mm | | density | 1.290±0.06 g/cm3(Predicted) | | Fp | >110°(230°F) | | refractive index | 1.5550 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Off-White | | Sensitive | Moisture Sensitive | | InChI | 1S/C8H9ClO2S/c1-6-3-4-8(7(2)5-6)12(9,10)11/h3-5H,1-2H3 | | InChIKey | FREOGXBZEAMJQN-UHFFFAOYSA-N | | SMILES | Cc1ccc(c(C)c1)S(Cl)(=O)=O | | CAS DataBase Reference | 609-60-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonyl chloride, 2,4-dimethyl- (609-60-9) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-51-24/25-22-7/9-6 | | RIDADR | 3261 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2930909899 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| Provider | Language |
|
ALFA
| English |
| | 2,4-Dimethylbenzenesulfonyl chloride Usage And Synthesis |
| Uses | 2,4-Dimethylbenzenesulfonyl Chloride is used as a reagent in the synthesis of dimethyl benzimidazolones as potent and selective inhibitors of BRPF1 bromodomain. 2,4-Dimethylbenzenesulfonyl Chloride is also used as a reagent in the synthesis of quinazoline analogs as glucocerebrosidase inhibitors with chaperone activity for the treatment of Gaucher disease. |
| | 2,4-Dimethylbenzenesulfonyl chloride Preparation Products And Raw materials |
|