|
|
| | 2,6-BIS(2-PYRIDYL)-4(1H)-PYRIDONE Basic information | | Description |
| Product Name: | 2,6-BIS(2-PYRIDYL)-4(1H)-PYRIDONE | | Synonyms: | 2,6-BIS(2-PYRIDYL)-4(1H)-PYRIDONE;2,6-Di(2-pyridyl)-4(1H)-pyridone;2,6-Bis(2-pyridyl)-4(1H)-pyridone ,98%;2,6-di(pyridin-2-yl)pyridin-4(1H)-one;2,6-Bis(2-pyridine)-4(1H)-pyridone;2,6-Bis(2-pyridyl)-4(1H)-pyridone 97%;1'H-[2,2';6',2'']Terpyridin-4'-one | | CAS: | 128143-88-4 | | MF: | C15H11N3O | | MW: | 249.27 | | EINECS: | | | Product Categories: | C9 to C46;Heterocyclic Building Blocks;Pyridines;Heterocyclic Compounds | | Mol File: | 128143-88-4.mol |  |
| | 2,6-BIS(2-PYRIDYL)-4(1H)-PYRIDONE Chemical Properties |
| Melting point | 168-170 °C(lit.) | | Boiling point | 505.5±50.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | -0.16±0.69(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C15H11N3O/c19-11-9-14(12-5-1-3-7-16-12)18-15(10-11)13-6-2-4-8-17-13/h1-10H,(H,18,19) | | InChIKey | HRORSVNZQWCZTD-UHFFFAOYSA-N | | SMILES | C1(C2NC(C3=NC=CC=C3)=CC(=O)C=2)=NC=CC=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29333990 |
| | 2,6-BIS(2-PYRIDYL)-4(1H)-PYRIDONE Usage And Synthesis |
| Description | 2,6-Bis(2-pyridyl)-4(1H)-pyridone belongs to heterocyclic derivatives and can be used as pharmaceutical intermediates. | | Chemical Properties | White to yellow to brown solid | | Uses | 2,6-Bis(2-pyridyl)-4(1H)-pyridone can be used a heterocyclic building block to prepare 4′-substituted terpyridines by reacting with ω-substituted primary alcohols or nucleosides via Mitsunobu reaction. It is also used to prepare cyclotriphosphazene ligands with pendant terpyridine moieties. |
| | 2,6-BIS(2-PYRIDYL)-4(1H)-PYRIDONE Preparation Products And Raw materials |
|