|
|
| | ACETYL CHLORIDE-D3 Basic information |
| | ACETYL CHLORIDE-D3 Chemical Properties |
| Melting point | -112 °C(lit.) | | Boiling point | 52 °C(lit.) | | density | 1.146 g/mL at 25 °C | | vapor density | 2.7 (vs air) | | vapor pressure | 4.97 psi ( 20 °C) | | refractive index | n20/D 1.3865(lit.) | | Fp | 40 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | liquid | | color | Colourless to slightly yellowish | | explosive limit | 19% | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C2H3ClO/c1-2(3)4/h1H3/i1D3 | | InChIKey | WETWJCDKMRHUPV-FIBGUPNXSA-N | | SMILES | C(=O)(Cl)C([2H])([2H])[2H] | | CAS Number Unlabeled | 75-36-5 |
| Hazard Codes | F,C | | Risk Statements | 11-14-34 | | Safety Statements | 9-16-23-45-26 | | RIDADR | UN 1717 3/PG 2 | | WGK Germany | 3 | | Autoignition Temperature | 1353 °F | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B |
| | ACETYL CHLORIDE-D3 Usage And Synthesis |
| Chemical Properties | ACETYL CHLORIDE-D3 is clear colorless liquid | | Uses | ACETYL CHLORIDE-D3 is a derivative of acetic acid, a weak acid, used as a reagent in numerous industrial processes. | | Definition | ChEBI: Acetyl chloride-d3 is an acyl chloride. |
| | ACETYL CHLORIDE-D3 Preparation Products And Raw materials |
|