- Afatinib impurity 17
-
- $0.00 / 10mg
-
2026-01-23
- CAS:162012-70-6
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | 4-CHLORO-7-FLUORO-6-NITRO-QUINAZOLINE Basic information |
| Product Name: | 4-CHLORO-7-FLUORO-6-NITRO-QUINAZOLINE | | Synonyms: | 4-CHLORO-7-FLUORO-6-NITRO-QUINAZOLINE;4-CHLORO-7-FLUORO-6-NITRO-QUINAZOLINE###162012-70-6;4-chloro-6-nitro-7-fluoro-quinazoline;Afatinib impurity 6: 4-chloro-7fluoro-6-nitroquinazoline;Quinazoline, 4-chloro-7-fluoro-6-nitro- | | CAS: | 162012-70-6 | | MF: | C8H3ClFN3O2 | | MW: | 227.58 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 162012-70-6.mol |  |
| | 4-CHLORO-7-FLUORO-6-NITRO-QUINAZOLINE Chemical Properties |
| Boiling point | 395℃ | | density | 1.649 | | Fp | 193℃ | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 0.53±0.70(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C8H3ClFN3O2/c9-8-4-1-7(13(14)15)5(10)2-6(4)11-3-12-8/h1-3H | | InChIKey | UYQMNEZWVKRWMS-UHFFFAOYSA-N | | SMILES | N1=C2C(C=C([N+]([O-])=O)C(F)=C2)=C(Cl)N=C1 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 |
| | 4-CHLORO-7-FLUORO-6-NITRO-QUINAZOLINE Usage And Synthesis |
| Uses | 4-Chloro-7-fluoro-6-nitroquinazoline is an intermediate in the synthesis of Afatinib (A355300), an aminocrotonylamino-substituted quinazoline derivative used for treating cancer and diseases of the respiratory tract, lungs, gastrointestinal tract, bile duct, and gallbladder. |
| | 4-CHLORO-7-FLUORO-6-NITRO-QUINAZOLINE Preparation Products And Raw materials |
|